C28H39N5O9S — CID 87619098
[2-ethoxy-3-[4-[3-(4-methylsulfonyloxyphenyl)propoxycarbonylamino]phenyl]propanoyl] (2S)-2-amino-5-(diaminomethylideneamino)pentanoate (PubChem CID 87619098) has the molecular formula C28H39N5O9S and a molecular weight of 621.71 g/mol. Its IUPAC name is [2-ethoxy-3-[4-[3-(4-methylsulfonyloxyphenyl)propoxycarbonylamino]phenyl]propanoyl] (2S)-2-amino-5-(diaminomethylideneamino)pentanoate.
| Compound Name | [2-ethoxy-3-[4-[3-(4-methylsulfonyloxyphenyl)propoxycarbonylamino]phenyl]propanoyl] (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 87619098 |
| Molecular Formula | C28H39N5O9S |
| Molecular Weight | 621.71 g/mol |
| Exact Mass | 621.25 |
| IUPAC Name | [2-ethoxy-3-[4-[3-(4-methylsulfonyloxyphenyl)propoxycarbonylamino]phenyl]propanoyl] (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
| SMILES | CCOC(Cc1ccc(NC(=O)OCCCc2ccc(OS(C)(=O)=O)cc2)cc1)C(=O)OC(=O)[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C28H39N5O9S/c1-3-39-24(26(35)41-25(34)23(29)7-4-16-32-27(30)31)18-20-8-12-21(13-9-20)33-28(36)40-17-5-6-19-10-14-22(15-11-19)42-43(2,37)38/h8-15,23-24H,3-7,16-18,29H2,1-2H3,(H,33,36)(H4,30,31,32)/t23-,24?/m0/s1 |
| InChIKey | MFAFEFQSXFETIK-UXMRNZNESA-N |
| XLogP | 1.60 |
| TPSA | 224.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.71 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|