C21H25NO6S — CID 59639976
(2S)-2-ethoxy-3-[4-[[(E)-3-(4-methylsulfonyloxyphenyl)prop-2-enyl]amino]phenyl]propanoic acid (PubChem CID 59639976) has the molecular formula C21H25NO6S and a molecular weight of 419.50 g/mol. Its IUPAC name is (2S)-2-ethoxy-3-[4-[[(E)-3-(4-methylsulfonyloxyphenyl)prop-2-enyl]amino]phenyl]propanoic acid.
| Compound Name | (2S)-2-ethoxy-3-[4-[[(E)-3-(4-methylsulfonyloxyphenyl)prop-2-enyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 59639976 |
| Molecular Formula | C21H25NO6S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | (2S)-2-ethoxy-3-[4-[[(E)-3-(4-methylsulfonyloxyphenyl)prop-2-enyl]amino]phenyl]propanoic acid |
| SMILES | CCO[C@@H](Cc1ccc(NC/C=C/c2ccc(OS(C)(=O)=O)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C21H25NO6S/c1-3-27-20(21(23)24)15-17-6-10-18(11-7-17)22-14-4-5-16-8-12-19(13-9-16)28-29(2,25)26/h4-13,20,22H,3,14-15H2,1-2H3,(H,23,24)/b5-4+/t20-/m0/s1 |
| InChIKey | FUEUYPMOEQMXNB-SGSXCFNPSA-N |
| XLogP | 3.18 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|