C27H27NO7S — CID 91304700
(2S)-3-[4-[benzoyl-[3-(4-methylsulfonyloxyphenyl)prop-2-enyl]amino]phenyl]-2-methoxypropanoic acid (PubChem CID 91304700) has the molecular formula C27H27NO7S and a molecular weight of 509.58 g/mol. Its IUPAC name is (2S)-3-[4-[benzoyl-[3-(4-methylsulfonyloxyphenyl)prop-2-enyl]amino]phenyl]-2-methoxypropanoic acid.
| Compound Name | (2S)-3-[4-[benzoyl-[3-(4-methylsulfonyloxyphenyl)prop-2-enyl]amino]phenyl]-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 91304700 |
| Molecular Formula | C27H27NO7S |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | (2S)-3-[4-[benzoyl-[3-(4-methylsulfonyloxyphenyl)prop-2-enyl]amino]phenyl]-2-methoxypropanoic acid |
| SMILES | CO[C@@H](Cc1ccc(N(CC=Cc2ccc(OS(C)(=O)=O)cc2)C(=O)c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C27H27NO7S/c1-34-25(27(30)31)19-21-10-14-23(15-11-21)28(26(29)22-8-4-3-5-9-22)18-6-7-20-12-16-24(17-13-20)35-36(2,32)33/h3-17,25H,18-19H2,1-2H3,(H,30,31)/t25-/m0/s1 |
| InChIKey | SJWOIKTZCHVBHY-VWLOTQADSA-N |
| XLogP | 4.03 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|