C25H25NO3 — CID 42696235
N,2-bis(4-methoxyphenyl)-N-[(E)-3-phenylprop-2-enyl]acetamide (PubChem CID 42696235) has the molecular formula C25H25NO3 and a molecular weight of 387.48 g/mol. Its IUPAC name is N,2-bis(4-methoxyphenyl)-N-[(E)-3-phenylprop-2-enyl]acetamide.
| Compound Name | N,2-bis(4-methoxyphenyl)-N-[(E)-3-phenylprop-2-enyl]acetamide |
|---|---|
| PubChem CID | 42696235 |
| Molecular Formula | C25H25NO3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N,2-bis(4-methoxyphenyl)-N-[(E)-3-phenylprop-2-enyl]acetamide |
| SMILES | COc1ccc(CC(=O)N(C/C=C/c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H25NO3/c1-28-23-14-10-21(11-15-23)19-25(27)26(22-12-16-24(29-2)17-13-22)18-6-9-20-7-4-3-5-8-20/h3-17H,18-19H2,1-2H3/b9-6+ |
| InChIKey | UGQUTWWIFNTKGO-RMKNXTFCSA-N |
| XLogP | 4.99 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |