C27H29NO3 — CID 42697314
N-(4-ethoxyphenyl)-2-(4-methoxyphenyl)-N-[(E)-2-methyl-3-phenylprop-2-enyl]acetamide (PubChem CID 42697314) has the molecular formula C27H29NO3 and a molecular weight of 415.53 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-(4-methoxyphenyl)-N-[(E)-2-methyl-3-phenylprop-2-enyl]acetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-(4-methoxyphenyl)-N-[(E)-2-methyl-3-phenylprop-2-enyl]acetamide |
|---|---|
| PubChem CID | 42697314 |
| Molecular Formula | C27H29NO3 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-(4-methoxyphenyl)-N-[(E)-2-methyl-3-phenylprop-2-enyl]acetamide |
| SMILES | CCOc1ccc(N(C/C(C)=C/c2ccccc2)C(=O)Cc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H29NO3/c1-4-31-26-16-12-24(13-17-26)28(20-21(2)18-22-8-6-5-7-9-22)27(29)19-23-10-14-25(30-3)15-11-23/h5-18H,4,19-20H2,1-3H3/b21-18+ |
| InChIKey | FASUNYPGYWHEEU-DYTRJAOYSA-N |
| XLogP | 5.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |