C25H31NO2 — CID 42697749
3-cyclopentyl-N-(4-methoxyphenyl)-N-[(E)-2-methyl-3-phenylprop-2-enyl]propanamide (PubChem CID 42697749) has the molecular formula C25H31NO2 and a molecular weight of 377.53 g/mol. Its IUPAC name is 3-cyclopentyl-N-(4-methoxyphenyl)-N-[(E)-2-methyl-3-phenylprop-2-enyl]propanamide.
| Compound Name | 3-cyclopentyl-N-(4-methoxyphenyl)-N-[(E)-2-methyl-3-phenylprop-2-enyl]propanamide |
|---|---|
| PubChem CID | 42697749 |
| Molecular Formula | C25H31NO2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | 3-cyclopentyl-N-(4-methoxyphenyl)-N-[(E)-2-methyl-3-phenylprop-2-enyl]propanamide |
| SMILES | COc1ccc(N(C/C(C)=C/c2ccccc2)C(=O)CCC2CCCC2)cc1 |
| InChI | InChI=1S/C25H31NO2/c1-20(18-22-10-4-3-5-11-22)19-26(23-13-15-24(28-2)16-14-23)25(27)17-12-21-8-6-7-9-21/h3-5,10-11,13-16,18,21H,6-9,12,17,19H2,1-2H3/b20-18+ |
| InChIKey | KGRNPFCHLIUCSU-CZIZESTLSA-N |
| XLogP | 6.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |