C20H29NO — CID 42697539
N-cyclohexyl-N-[(E)-2-methyl-3-phenylprop-2-enyl]butanamide (PubChem CID 42697539) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is N-cyclohexyl-N-[(E)-2-methyl-3-phenylprop-2-enyl]butanamide.
| Compound Name | N-cyclohexyl-N-[(E)-2-methyl-3-phenylprop-2-enyl]butanamide |
|---|---|
| PubChem CID | 42697539 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | N-cyclohexyl-N-[(E)-2-methyl-3-phenylprop-2-enyl]butanamide |
| SMILES | CCCC(=O)N(C/C(C)=C/c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C20H29NO/c1-3-10-20(22)21(19-13-8-5-9-14-19)16-17(2)15-18-11-6-4-7-12-18/h4,6-7,11-12,15,19H,3,5,8-10,13-14,16H2,1-2H3/b17-15+ |
| InChIKey | SCIMOUJXZYEHJK-BMRADRMJSA-N |
| XLogP | 5.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |