C28H33NO5 — CID 10766526
benzyl 4-[(E)-3-[cyclohexyl-(2-ethoxy-2-oxoethyl)amino]-2-methyl-3-oxoprop-1-enyl]benzoate (PubChem CID 10766526) has the molecular formula C28H33NO5 and a molecular weight of 463.57 g/mol. Its IUPAC name is benzyl 4-[(E)-3-[cyclohexyl-(2-ethoxy-2-oxoethyl)amino]-2-methyl-3-oxoprop-1-enyl]benzoate.
| Compound Name | benzyl 4-[(E)-3-[cyclohexyl-(2-ethoxy-2-oxoethyl)amino]-2-methyl-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 10766526 |
| Molecular Formula | C28H33NO5 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | benzyl 4-[(E)-3-[cyclohexyl-(2-ethoxy-2-oxoethyl)amino]-2-methyl-3-oxoprop-1-enyl]benzoate |
| SMILES | CCOC(=O)CN(C(=O)/C(C)=C/c1ccc(C(=O)OCc2ccccc2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C28H33NO5/c1-3-33-26(30)19-29(25-12-8-5-9-13-25)27(31)21(2)18-22-14-16-24(17-15-22)28(32)34-20-23-10-6-4-7-11-23/h4,6-7,10-11,14-18,25H,3,5,8-9,12-13,19-20H2,1-2H3/b21-18+ |
| InChIKey | VVDQCISUDZNELK-DYTRJAOYSA-N |
| XLogP | 5.17 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|