About benzyl benzoate;ethyl 3-oxobutanoate
benzyl benzoate;ethyl 3-oxobutanoate (PubChem CID 174984121) has the molecular formula C20H22O5
and a molecular weight of 342.39 g/mol. Its IUPAC name is benzyl benzoate;ethyl 3-oxobutanoate.
Molecular Properties
| Compound Name | benzyl benzoate;ethyl 3-oxobutanoate |
| PubChem CID | 174984121 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | benzyl benzoate;ethyl 3-oxobutanoate |
| SMILES | CCOC(=O)CC(C)=O.O=C(OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12O2.C6H10O3/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12;1-3-9-6(8)4-5(2)7/h1-10H,11H2;3-4H2,1-2H3 |
| InChIKey | JJYBSEJAPBUAJS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze benzyl benzoate;ethyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl benzoate;ethyl 3-oxobutanoate?
The IUPAC name of benzyl benzoate;ethyl 3-oxobutanoate (CID 174984121) is benzyl benzoate;ethyl 3-oxobutanoate.
What is the SMILES notation for benzyl benzoate;ethyl 3-oxobutanoate?
The canonical SMILES for benzyl benzoate;ethyl 3-oxobutanoate is CCOC(=O)CC(C)=O.O=C(OCc1ccccc1)c1ccccc1.
What is the InChIKey of benzyl benzoate;ethyl 3-oxobutanoate?
The InChIKey is JJYBSEJAPBUAJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O2.C6H10O3/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12;1-3-9-6(8)4-5(2)7/h1-10H,11H2;3-4H2,1-2H3.
What are the key properties of benzyl benzoate;ethyl 3-oxobutanoate?
benzyl benzoate;ethyl 3-oxobutanoate has a molecular weight of 342.39 g/mol, XLogP of 3.57, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl benzoate;ethyl 3-oxobutanoate is sourced from PubChem (CID 174984121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).