About benzyl 3-oxobutanoate;2-methylpentane
benzyl 3-oxobutanoate;2-methylpentane (PubChem CID 174912081) has the molecular formula C17H26O3
and a molecular weight of 278.39 g/mol. Its IUPAC name is benzyl 3-oxobutanoate;2-methylpentane.
Molecular Properties
| Compound Name | benzyl 3-oxobutanoate;2-methylpentane |
| PubChem CID | 174912081 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | benzyl 3-oxobutanoate;2-methylpentane |
| SMILES | CC(=O)CC(=O)OCc1ccccc1.CCCC(C)C |
| InChI | InChI=1S/C11H12O3.C6H14/c1-9(12)7-11(13)14-8-10-5-3-2-4-6-10;1-4-5-6(2)3/h2-6H,7-8H2,1H3;6H,4-5H2,1-3H3 |
| InChIKey | XJAYOJIMYSYCNG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze benzyl 3-oxobutanoate;2-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 3-oxobutanoate;2-methylpentane?
The IUPAC name of benzyl 3-oxobutanoate;2-methylpentane (CID 174912081) is benzyl 3-oxobutanoate;2-methylpentane.
What is the SMILES notation for benzyl 3-oxobutanoate;2-methylpentane?
The canonical SMILES for benzyl 3-oxobutanoate;2-methylpentane is CC(=O)CC(=O)OCc1ccccc1.CCCC(C)C.
What is the InChIKey of benzyl 3-oxobutanoate;2-methylpentane?
The InChIKey is XJAYOJIMYSYCNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3.C6H14/c1-9(12)7-11(13)14-8-10-5-3-2-4-6-10;1-4-5-6(2)3/h2-6H,7-8H2,1H3;6H,4-5H2,1-3H3.
What are the key properties of benzyl 3-oxobutanoate;2-methylpentane?
benzyl 3-oxobutanoate;2-methylpentane has a molecular weight of 278.39 g/mol, XLogP of 4.15, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-oxobutanoate;2-methylpentane is sourced from PubChem (CID 174912081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).