C17H23NO4 — CID 69287668
benzyl 2-[cyclohexyl-(2-hydroxyacetyl)amino]acetate (PubChem CID 69287668) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is benzyl 2-[cyclohexyl-(2-hydroxyacetyl)amino]acetate.
| Compound Name | benzyl 2-[cyclohexyl-(2-hydroxyacetyl)amino]acetate |
|---|---|
| PubChem CID | 69287668 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | benzyl 2-[cyclohexyl-(2-hydroxyacetyl)amino]acetate |
| SMILES | O=C(CN(C(=O)CO)C1CCCCC1)OCc1ccccc1 |
| InChI | InChI=1S/C17H23NO4/c19-12-16(20)18(15-9-5-2-6-10-15)11-17(21)22-13-14-7-3-1-4-8-14/h1,3-4,7-8,15,19H,2,5-6,9-13H2 |
| InChIKey | FZBHYTHUYUHHBT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |