C20H23NO4S — CID 100967511
benzyl N-(benzenesulfonyl)-N-cyclohexylcarbamate (PubChem CID 100967511) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is benzyl N-(benzenesulfonyl)-N-cyclohexylcarbamate.
| Compound Name | benzyl N-(benzenesulfonyl)-N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 100967511 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | benzyl N-(benzenesulfonyl)-N-cyclohexylcarbamate |
| SMILES | O=C(OCc1ccccc1)N(C1CCCCC1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H23NO4S/c22-20(25-16-17-10-4-1-5-11-17)21(18-12-6-2-7-13-18)26(23,24)19-14-8-3-9-15-19/h1,3-5,8-11,14-15,18H,2,6-7,12-13,16H2 |
| InChIKey | WHNGIUQIHMIPPF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |