C16H22N2O5 — CID 67867959
benzyl N-(2-aminoacetyl)-N-(2,6-dihydroxycyclohexyl)carbamate (PubChem CID 67867959) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is benzyl N-(2-aminoacetyl)-N-(2,6-dihydroxycyclohexyl)carbamate.
| Compound Name | benzyl N-(2-aminoacetyl)-N-(2,6-dihydroxycyclohexyl)carbamate |
|---|---|
| PubChem CID | 67867959 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | benzyl N-(2-aminoacetyl)-N-(2,6-dihydroxycyclohexyl)carbamate |
| SMILES | NCC(=O)N(C(=O)OCc1ccccc1)C1C(O)CCCC1O |
| InChI | InChI=1S/C16H22N2O5/c17-9-14(21)18(15-12(19)7-4-8-13(15)20)16(22)23-10-11-5-2-1-3-6-11/h1-3,5-6,12-13,15,19-20H,4,7-10,17H2 |
| InChIKey | RNFAQYUXLNGTHV-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |