C15H20N2O4 — CID 100967512
benzyl N-cyclohexyl-N-(nitromethyl)carbamate (PubChem CID 100967512) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is benzyl N-cyclohexyl-N-(nitromethyl)carbamate.
| Compound Name | benzyl N-cyclohexyl-N-(nitromethyl)carbamate |
|---|---|
| PubChem CID | 100967512 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | benzyl N-cyclohexyl-N-(nitromethyl)carbamate |
| SMILES | O=C(OCc1ccccc1)N(C[N+](=O)[O-])C1CCCCC1 |
| InChI | InChI=1S/C15H20N2O4/c18-15(21-11-13-7-3-1-4-8-13)16(12-17(19)20)14-9-5-2-6-10-14/h1,3-4,7-8,14H,2,5-6,9-12H2 |
| InChIKey | SHWGUURJNQPJFW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|