C17H27N3O2 — CID 66566566
benzyl N-[1-(2-aminoethyl)piperidin-3-yl]-N-ethylcarbamate (PubChem CID 66566566) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is benzyl N-[1-(2-aminoethyl)piperidin-3-yl]-N-ethylcarbamate.
| Compound Name | benzyl N-[1-(2-aminoethyl)piperidin-3-yl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 66566566 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | benzyl N-[1-(2-aminoethyl)piperidin-3-yl]-N-ethylcarbamate |
| SMILES | CCN(C(=O)OCc1ccccc1)C1CCCN(CCN)C1 |
| InChI | InChI=1S/C17H27N3O2/c1-2-20(16-9-6-11-19(13-16)12-10-18)17(21)22-14-15-7-4-3-5-8-15/h3-5,7-8,16H,2,6,9-14,18H2,1H3 |
| InChIKey | AHPMNZWTROIHIK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |