C17H23ClN2O3 — CID 66566616
benzyl N-[1-(2-chloroacetyl)piperidin-3-yl]-N-ethylcarbamate (PubChem CID 66566616) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.83 g/mol. Its IUPAC name is benzyl N-[1-(2-chloroacetyl)piperidin-3-yl]-N-ethylcarbamate.
| Compound Name | benzyl N-[1-(2-chloroacetyl)piperidin-3-yl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 66566616 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.83 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | benzyl N-[1-(2-chloroacetyl)piperidin-3-yl]-N-ethylcarbamate |
| SMILES | CCN(C(=O)OCc1ccccc1)C1CCCN(C(=O)CCl)C1 |
| InChI | InChI=1S/C17H23ClN2O3/c1-2-20(15-9-6-10-19(12-15)16(21)11-18)17(22)23-13-14-7-4-3-5-8-14/h3-5,7-8,15H,2,6,9-13H2,1H3 |
| InChIKey | KKVIMCATPDQPDU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.83 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|