C28H36N2O4 — CID 59224555
benzyl N-[3-[cycloheptyl(2-oxoethyl)amino]-3-oxopropyl]-N-(2-phenylethyl)carbamate (PubChem CID 59224555) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is benzyl N-[3-[cycloheptyl(2-oxoethyl)amino]-3-oxopropyl]-N-(2-phenylethyl)carbamate.
| Compound Name | benzyl N-[3-[cycloheptyl(2-oxoethyl)amino]-3-oxopropyl]-N-(2-phenylethyl)carbamate |
|---|---|
| PubChem CID | 59224555 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | benzyl N-[3-[cycloheptyl(2-oxoethyl)amino]-3-oxopropyl]-N-(2-phenylethyl)carbamate |
| SMILES | O=CCN(C(=O)CCN(CCc1ccccc1)C(=O)OCc1ccccc1)C1CCCCCC1 |
| InChI | InChI=1S/C28H36N2O4/c31-22-21-30(26-15-9-1-2-10-16-26)27(32)18-20-29(19-17-24-11-5-3-6-12-24)28(33)34-23-25-13-7-4-8-14-25/h3-8,11-14,22,26H,1-2,9-10,15-21,23H2 |
| InChIKey | HPDIAMNLDSKJLN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|