C14H17NO4 — CID 71733448
benzyl N-[(1R,2R)-2-formylcyclopentyl]-N-hydroxycarbamate (PubChem CID 71733448) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is benzyl N-[(1R,2R)-2-formylcyclopentyl]-N-hydroxycarbamate.
| Compound Name | benzyl N-[(1R,2R)-2-formylcyclopentyl]-N-hydroxycarbamate |
|---|---|
| PubChem CID | 71733448 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | benzyl N-[(1R,2R)-2-formylcyclopentyl]-N-hydroxycarbamate |
| SMILES | O=C[C@@H]1CCC[C@H]1N(O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H17NO4/c16-9-12-7-4-8-13(12)15(18)14(17)19-10-11-5-2-1-3-6-11/h1-3,5-6,9,12-13,18H,4,7-8,10H2/t12-,13+/m0/s1 |
| InChIKey | BEKIISLNULAFBR-QWHCGFSZSA-N |
| XLogP | 2.38 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|