C22H30N2O3S — CID 10222783
N-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-N-cyclohexylbenzenesulfonamide (PubChem CID 10222783) has the molecular formula C22H30N2O3S and a molecular weight of 402.56 g/mol. Its IUPAC name is N-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-N-cyclohexylbenzenesulfonamide.
| Compound Name | N-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-N-cyclohexylbenzenesulfonamide |
|---|---|
| PubChem CID | 10222783 |
| Molecular Formula | C22H30N2O3S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | N-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-N-cyclohexylbenzenesulfonamide |
| SMILES | N[C@@H](Cc1ccccc1)[C@H](O)CN(C1CCCCC1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H30N2O3S/c23-21(16-18-10-4-1-5-11-18)22(25)17-24(19-12-6-2-7-13-19)28(26,27)20-14-8-3-9-15-20/h1,3-5,8-11,14-15,19,21-22,25H,2,6-7,12-13,16-17,23H2/t21-,22+/m0/s1 |
| InChIKey | KLFLAWJJOAKACH-FCHUYYIVSA-N |
| XLogP | 2.94 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |