C20H29ClN2O4S — CID 87740079
N-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-N-[(2-methylpropan-2-yl)oxy]benzenesulfonamide;hydrochloride (PubChem CID 87740079) has the molecular formula C20H29ClN2O4S and a molecular weight of 428.98 g/mol. Its IUPAC name is N-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-N-[(2-methylpropan-2-yl)oxy]benzenesulfonamide;hydrochloride.
| Compound Name | N-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-N-[(2-methylpropan-2-yl)oxy]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 87740079 |
| Molecular Formula | C20H29ClN2O4S |
| Molecular Weight | 428.98 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | N-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-N-[(2-methylpropan-2-yl)oxy]benzenesulfonamide;hydrochloride |
| SMILES | CC(C)(C)ON(C[C@@H](O)[C@@H](N)Cc1ccccc1)S(=O)(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C20H28N2O4S.ClH/c1-20(2,3)26-22(27(24,25)17-12-8-5-9-13-17)15-19(23)18(21)14-16-10-6-4-7-11-16;/h4-13,18-19,23H,14-15,21H2,1-3H3;1H/t18-,19+;/m0./s1 |
| InChIKey | LGLZSAIKRSFYDA-GRTNUQQKSA-N |
| XLogP | 2.76 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.98 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|