C17H29N3O — CID 10756020
(2R,3S)-3-amino-1-[amino(cyclohexylmethyl)amino]-4-phenylbutan-2-ol (PubChem CID 10756020) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is (2R,3S)-3-amino-1-[amino(cyclohexylmethyl)amino]-4-phenylbutan-2-ol.
| Compound Name | (2R,3S)-3-amino-1-[amino(cyclohexylmethyl)amino]-4-phenylbutan-2-ol |
|---|---|
| PubChem CID | 10756020 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | (2R,3S)-3-amino-1-[amino(cyclohexylmethyl)amino]-4-phenylbutan-2-ol |
| SMILES | N[C@@H](Cc1ccccc1)[C@H](O)CN(N)CC1CCCCC1 |
| InChI | InChI=1S/C17H29N3O/c18-16(11-14-7-3-1-4-8-14)17(21)13-20(19)12-15-9-5-2-6-10-15/h1,3-4,7-8,15-17,21H,2,5-6,9-13,18-19H2/t16-,17+/m0/s1 |
| InChIKey | UJWJNBXMVZEZPT-DLBZAZTESA-N |
| XLogP | 1.67 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|