C21H28N2O — CID 15947125
(2S,3R)-3-amino-4-phenyl-1-(3-phenylpiperidin-1-yl)butan-2-ol (PubChem CID 15947125) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is (2S,3R)-3-amino-4-phenyl-1-(3-phenylpiperidin-1-yl)butan-2-ol.
| Compound Name | (2S,3R)-3-amino-4-phenyl-1-(3-phenylpiperidin-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 15947125 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | (2S,3R)-3-amino-4-phenyl-1-(3-phenylpiperidin-1-yl)butan-2-ol |
| SMILES | N[C@H](Cc1ccccc1)[C@@H](O)CN1CCCC(c2ccccc2)C1 |
| InChI | InChI=1S/C21H28N2O/c22-20(14-17-8-3-1-4-9-17)21(24)16-23-13-7-12-19(15-23)18-10-5-2-6-11-18/h1-6,8-11,19-21,24H,7,12-16,22H2/t19?,20-,21+/m1/s1 |
| InChIKey | VENZOXFJGCEQJK-JUODMZLFSA-N |
| XLogP | 2.80 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |