C17H27N3O2 — CID 139013773
N-[1-[(2S,3S)-3-amino-2-hydroxy-4-phenylbutyl]piperidin-3-yl]acetamide (PubChem CID 139013773) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is N-[1-[(2S,3S)-3-amino-2-hydroxy-4-phenylbutyl]piperidin-3-yl]acetamide.
| Compound Name | N-[1-[(2S,3S)-3-amino-2-hydroxy-4-phenylbutyl]piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 139013773 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | N-[1-[(2S,3S)-3-amino-2-hydroxy-4-phenylbutyl]piperidin-3-yl]acetamide |
| SMILES | CC(=O)NC1CCCN(C[C@H](O)[C@@H](N)Cc2ccccc2)C1 |
| InChI | InChI=1S/C17H27N3O2/c1-13(21)19-15-8-5-9-20(11-15)12-17(22)16(18)10-14-6-3-2-4-7-14/h2-4,6-7,15-17,22H,5,8-12,18H2,1H3,(H,19,21)/t15?,16-,17-/m0/s1 |
| InChIKey | KFTSNSLCTIHCCR-BSOSBYQFSA-N |
| XLogP | 0.52 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |