C14H26Cl2N2O2S — CID 161196284
(2S,3R)-3-amino-1-morpholin-4-yl-4-phenylbutan-2-ol;sulfane;dihydrochloride (PubChem CID 161196284) has the molecular formula C14H26Cl2N2O2S and a molecular weight of 357.35 g/mol. Its IUPAC name is (2S,3R)-3-amino-1-morpholin-4-yl-4-phenylbutan-2-ol;sulfane;dihydrochloride.
| Compound Name | (2S,3R)-3-amino-1-morpholin-4-yl-4-phenylbutan-2-ol;sulfane;dihydrochloride |
|---|---|
| PubChem CID | 161196284 |
| Molecular Formula | C14H26Cl2N2O2S |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | (2S,3R)-3-amino-1-morpholin-4-yl-4-phenylbutan-2-ol;sulfane;dihydrochloride |
| SMILES | Cl.Cl.N[C@H](Cc1ccccc1)[C@@H](O)CN1CCOCC1.S |
| InChI | InChI=1S/C14H22N2O2.2ClH.H2S/c15-13(10-12-4-2-1-3-5-12)14(17)11-16-6-8-18-9-7-16;;;/h1-5,13-14,17H,6-11,15H2;2*1H;1H2/t13-,14+;;;/m1.../s1 |
| InChIKey | RLIDCMTZZRODQT-IEJPZSQASA-N |
| XLogP | 1.21 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |