C22H28F3N3O — CID 166105707
3-amino-4-phenyl-1-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]butan-2-ol (PubChem CID 166105707) has the molecular formula C22H28F3N3O and a molecular weight of 407.48 g/mol. Its IUPAC name is 3-amino-4-phenyl-1-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]butan-2-ol.
| Compound Name | 3-amino-4-phenyl-1-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]butan-2-ol |
|---|---|
| PubChem CID | 166105707 |
| Molecular Formula | C22H28F3N3O |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 3-amino-4-phenyl-1-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]butan-2-ol |
| SMILES | NC(Cc1ccccc1)C(O)CN1CCN(Cc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H28F3N3O/c23-22(24,25)19-8-6-18(7-9-19)15-27-10-12-28(13-11-27)16-21(29)20(26)14-17-4-2-1-3-5-17/h1-9,20-21,29H,10-16,26H2 |
| InChIKey | PIQIPWJVTALDDC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |