C22H25F3N4O2 — CID 42572867
1-benzyl-3-[2-oxo-2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]ethyl]urea (PubChem CID 42572867) has the molecular formula C22H25F3N4O2 and a molecular weight of 434.46 g/mol. Its IUPAC name is 1-benzyl-3-[2-oxo-2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]ethyl]urea.
| Compound Name | 1-benzyl-3-[2-oxo-2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]ethyl]urea |
|---|---|
| PubChem CID | 42572867 |
| Molecular Formula | C22H25F3N4O2 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 1-benzyl-3-[2-oxo-2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]ethyl]urea |
| SMILES | O=C(NCC(=O)N1CCN(Cc2ccc(C(F)(F)F)cc2)CC1)NCc1ccccc1 |
| InChI | InChI=1S/C22H25F3N4O2/c23-22(24,25)19-8-6-18(7-9-19)16-28-10-12-29(13-11-28)20(30)15-27-21(31)26-14-17-4-2-1-3-5-17/h1-9H,10-16H2,(H2,26,27,31) |
| InChIKey | QKQWVIJJAYMOBS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |