C21H23ClN4O3 — CID 46555188
1-benzyl-3-[2-[4-(4-chlorobenzoyl)piperazin-1-yl]-2-oxoethyl]urea (PubChem CID 46555188) has the molecular formula C21H23ClN4O3 and a molecular weight of 414.89 g/mol. Its IUPAC name is 1-benzyl-3-[2-[4-(4-chlorobenzoyl)piperazin-1-yl]-2-oxoethyl]urea.
| Compound Name | 1-benzyl-3-[2-[4-(4-chlorobenzoyl)piperazin-1-yl]-2-oxoethyl]urea |
|---|---|
| PubChem CID | 46555188 |
| Molecular Formula | C21H23ClN4O3 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 1-benzyl-3-[2-[4-(4-chlorobenzoyl)piperazin-1-yl]-2-oxoethyl]urea |
| SMILES | O=C(NCC(=O)N1CCN(C(=O)c2ccc(Cl)cc2)CC1)NCc1ccccc1 |
| InChI | InChI=1S/C21H23ClN4O3/c22-18-8-6-17(7-9-18)20(28)26-12-10-25(11-13-26)19(27)15-24-21(29)23-14-16-4-2-1-3-5-16/h1-9H,10-15H2,(H2,23,24,29) |
| InChIKey | UUBBHOHGCJUXLB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |