C22H28N4O2 — CID 27841214
1-benzyl-3-[2-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-2-oxoethyl]urea (PubChem CID 27841214) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 1-benzyl-3-[2-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-2-oxoethyl]urea.
| Compound Name | 1-benzyl-3-[2-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-2-oxoethyl]urea |
|---|---|
| PubChem CID | 27841214 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 1-benzyl-3-[2-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-2-oxoethyl]urea |
| SMILES | Cc1ccccc1CN1CCN(C(=O)CNC(=O)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H28N4O2/c1-18-7-5-6-10-20(18)17-25-11-13-26(14-12-25)21(27)16-24-22(28)23-15-19-8-3-2-4-9-19/h2-10H,11-17H2,1H3,(H2,23,24,28) |
| InChIKey | OBYFILZNWHRBPC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |