C15H21ClN4O2 — CID 110615230
1-[(3-chlorophenyl)methyl]-3-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]urea (PubChem CID 110615230) has the molecular formula C15H21ClN4O2 and a molecular weight of 324.81 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-3-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]urea.
| Compound Name | 1-[(3-chlorophenyl)methyl]-3-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]urea |
|---|---|
| PubChem CID | 110615230 |
| Molecular Formula | C15H21ClN4O2 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-3-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]urea |
| SMILES | CN1CCN(C(=O)CNC(=O)NCc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C15H21ClN4O2/c1-19-5-7-20(8-6-19)14(21)11-18-15(22)17-10-12-3-2-4-13(16)9-12/h2-4,9H,5-8,10-11H2,1H3,(H2,17,18,22) |
| InChIKey | NGGCTDIDKRBTBI-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |