C24H29ClN4O2 — CID 162800380
N-benzyl-8-(4-chlorobenzoyl)-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide (PubChem CID 162800380) has the molecular formula C24H29ClN4O2 and a molecular weight of 440.98 g/mol. Its IUPAC name is N-benzyl-8-(4-chlorobenzoyl)-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide.
| Compound Name | N-benzyl-8-(4-chlorobenzoyl)-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 162800380 |
| Molecular Formula | C24H29ClN4O2 |
| Molecular Weight | 440.98 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | N-benzyl-8-(4-chlorobenzoyl)-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide |
| SMILES | CC1(C)CN(C(=O)NCc2ccccc2)CC2CN(C(=O)c3ccc(Cl)cc3)CCN21 |
| InChI | InChI=1S/C24H29ClN4O2/c1-24(2)17-28(23(31)26-14-18-6-4-3-5-7-18)16-21-15-27(12-13-29(21)24)22(30)19-8-10-20(25)11-9-19/h3-11,21H,12-17H2,1-2H3,(H,26,31) |
| InChIKey | ZRTIZPCELZODOA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.98 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |