C24H29N3O3 — CID 162800417
[8-(2-methoxybenzoyl)-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-phenylmethanone (PubChem CID 162800417) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is [8-(2-methoxybenzoyl)-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-phenylmethanone.
| Compound Name | [8-(2-methoxybenzoyl)-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 162800417 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | [8-(2-methoxybenzoyl)-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-phenylmethanone |
| SMILES | COc1ccccc1C(=O)N1CCN2C(CN(C(=O)c3ccccc3)CC2(C)C)C1 |
| InChI | InChI=1S/C24H29N3O3/c1-24(2)17-26(22(28)18-9-5-4-6-10-18)16-19-15-25(13-14-27(19)24)23(29)20-11-7-8-12-21(20)30-3/h4-12,19H,13-17H2,1-3H3 |
| InChIKey | BGFKQPAAYJCZIP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |