C24H28FN3O2 — CID 124875265
1-[(9aS)-2-(2-fluorobenzoyl)-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-2-phenylethanone (PubChem CID 124875265) has the molecular formula C24H28FN3O2 and a molecular weight of 409.51 g/mol. Its IUPAC name is 1-[(9aS)-2-(2-fluorobenzoyl)-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-2-phenylethanone.
| Compound Name | 1-[(9aS)-2-(2-fluorobenzoyl)-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 124875265 |
| Molecular Formula | C24H28FN3O2 |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 1-[(9aS)-2-(2-fluorobenzoyl)-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-2-phenylethanone |
| SMILES | CC1(C)CN(C(=O)c2ccccc2F)C[C@@H]2CN(C(=O)Cc3ccccc3)CCN21 |
| InChI | InChI=1S/C24H28FN3O2/c1-24(2)17-27(23(30)20-10-6-7-11-21(20)25)16-19-15-26(12-13-28(19)24)22(29)14-18-8-4-3-5-9-18/h3-11,19H,12-17H2,1-2H3/t19-/m0/s1 |
| InChIKey | GPHDXWDZYJNWNQ-IBGZPJMESA-N |
| XLogP | 2.82 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |