C16H20FN3O2 — CID 162898293
(2-fluorophenyl)-spiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine]-8-ylmethanone (PubChem CID 162898293) has the molecular formula C16H20FN3O2 and a molecular weight of 305.35 g/mol. Its IUPAC name is (2-fluorophenyl)-spiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine]-8-ylmethanone.
| Compound Name | (2-fluorophenyl)-spiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine]-8-ylmethanone |
|---|---|
| PubChem CID | 162898293 |
| Molecular Formula | C16H20FN3O2 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | (2-fluorophenyl)-spiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine]-8-ylmethanone |
| SMILES | O=C(c1ccccc1F)N1CC2COCCN2C2(CNC2)C1 |
| InChI | InChI=1S/C16H20FN3O2/c17-14-4-2-1-3-13(14)15(21)19-7-12-8-22-6-5-20(12)16(11-19)9-18-10-16/h1-4,12,18H,5-11H2 |
| InChIKey | QTARGJKJIURBMO-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |