C23H32N4O3 — CID 162790586
1-[4-(8-benzoylspiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine]-1'-yl)piperidin-1-yl]ethanone (PubChem CID 162790586) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is 1-[4-(8-benzoylspiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine]-1'-yl)piperidin-1-yl]ethanone.
| Compound Name | 1-[4-(8-benzoylspiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine]-1'-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 162790586 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 1-[4-(8-benzoylspiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine]-1'-yl)piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(N2CC3(CN(C(=O)c4ccccc4)CC4COCCN43)C2)CC1 |
| InChI | InChI=1S/C23H32N4O3/c1-18(28)24-9-7-20(8-10-24)26-16-23(17-26)15-25(13-21-14-30-12-11-27(21)23)22(29)19-5-3-2-4-6-19/h2-6,20-21H,7-17H2,1H3 |
| InChIKey | NRMWOMSYAAFOJO-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 56.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |