C20H27N3O2 — CID 163022736
(1'-cyclobutylspiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine]-8-yl)-phenylmethanone (PubChem CID 163022736) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is (1'-cyclobutylspiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine]-8-yl)-phenylmethanone.
| Compound Name | (1'-cyclobutylspiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine]-8-yl)-phenylmethanone |
|---|---|
| PubChem CID | 163022736 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | (1'-cyclobutylspiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine]-8-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CC2COCCN2C2(C1)CN(C1CCC1)C2 |
| InChI | InChI=1S/C20H27N3O2/c24-19(16-5-2-1-3-6-16)21-11-18-12-25-10-9-23(18)20(13-21)14-22(15-20)17-7-4-8-17/h1-3,5-6,17-18H,4,7-15H2 |
| InChIKey | UYZKRFXZOHYCOH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |