C23H33N3O4 — CID 163101221
(4-methoxyphenyl)-[1'-(oxan-4-ylmethyl)spiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine]-8-yl]methanone (PubChem CID 163101221) has the molecular formula C23H33N3O4 and a molecular weight of 415.53 g/mol. Its IUPAC name is (4-methoxyphenyl)-[1'-(oxan-4-ylmethyl)spiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine]-8-yl]methanone.
| Compound Name | (4-methoxyphenyl)-[1'-(oxan-4-ylmethyl)spiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine]-8-yl]methanone |
|---|---|
| PubChem CID | 163101221 |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | (4-methoxyphenyl)-[1'-(oxan-4-ylmethyl)spiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine]-8-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CC3COCCN3C3(CN(CC4CCOCC4)C3)C2)cc1 |
| InChI | InChI=1S/C23H33N3O4/c1-28-21-4-2-19(3-5-21)22(27)25-13-20-14-30-11-8-26(20)23(17-25)15-24(16-23)12-18-6-9-29-10-7-18/h2-5,18,20H,6-17H2,1H3 |
| InChIKey | VSBKAZHXBXWQHW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 54.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |