C24H34N4O4 — CID 162803189
1-[4-[8-(3-methoxybenzoyl)spiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine]-1'-yl]piperidin-1-yl]ethanone (PubChem CID 162803189) has the molecular formula C24H34N4O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is 1-[4-[8-(3-methoxybenzoyl)spiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine]-1'-yl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[8-(3-methoxybenzoyl)spiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine]-1'-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 162803189 |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 1-[4-[8-(3-methoxybenzoyl)spiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine]-1'-yl]piperidin-1-yl]ethanone |
| SMILES | COc1cccc(C(=O)N2CC3COCCN3C3(C2)CN(C2CCN(C(C)=O)CC2)C3)c1 |
| InChI | InChI=1S/C24H34N4O4/c1-18(29)25-8-6-20(7-9-25)27-16-24(17-27)15-26(13-21-14-32-11-10-28(21)24)23(30)19-4-3-5-22(12-19)31-2/h3-5,12,20-21H,6-11,13-17H2,1-2H3 |
| InChIKey | RPRQYLCAJYGYLL-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 65.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |