C14H19NO4 — CID 162818233
(6-methoxy-1,4-oxazepan-4-yl)-(3-methoxyphenyl)methanone (PubChem CID 162818233) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is (6-methoxy-1,4-oxazepan-4-yl)-(3-methoxyphenyl)methanone.
| Compound Name | (6-methoxy-1,4-oxazepan-4-yl)-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 162818233 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | (6-methoxy-1,4-oxazepan-4-yl)-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)N2CCOCC(OC)C2)c1 |
| InChI | InChI=1S/C14H19NO4/c1-17-12-5-3-4-11(8-12)14(16)15-6-7-19-10-13(9-15)18-2/h3-5,8,13H,6-7,9-10H2,1-2H3 |
| InChIKey | LKEHDLMGRGZRAK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |