C18H17Cl2NO3 — CID 121134461
[2-(3,5-dichlorophenyl)morpholin-4-yl]-(3-methoxyphenyl)methanone (PubChem CID 121134461) has the molecular formula C18H17Cl2NO3 and a molecular weight of 366.24 g/mol. Its IUPAC name is [2-(3,5-dichlorophenyl)morpholin-4-yl]-(3-methoxyphenyl)methanone.
| Compound Name | [2-(3,5-dichlorophenyl)morpholin-4-yl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 121134461 |
| Molecular Formula | C18H17Cl2NO3 |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | [2-(3,5-dichlorophenyl)morpholin-4-yl]-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)N2CCOC(c3cc(Cl)cc(Cl)c3)C2)c1 |
| InChI | InChI=1S/C18H17Cl2NO3/c1-23-16-4-2-3-12(9-16)18(22)21-5-6-24-17(11-21)13-7-14(19)10-15(20)8-13/h2-4,7-10,17H,5-6,11H2,1H3 |
| InChIKey | UNXAIQYUQPCNET-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |