C16H16ClNO3S — CID 124573395
(5-chlorothiophen-2-yl)-[(2R)-2-(3-methoxyphenyl)morpholin-4-yl]methanone (PubChem CID 124573395) has the molecular formula C16H16ClNO3S and a molecular weight of 337.83 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)-[(2R)-2-(3-methoxyphenyl)morpholin-4-yl]methanone.
| Compound Name | (5-chlorothiophen-2-yl)-[(2R)-2-(3-methoxyphenyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 124573395 |
| Molecular Formula | C16H16ClNO3S |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | (5-chlorothiophen-2-yl)-[(2R)-2-(3-methoxyphenyl)morpholin-4-yl]methanone |
| SMILES | COc1cccc([C@@H]2CN(C(=O)c3ccc(Cl)s3)CCO2)c1 |
| InChI | InChI=1S/C16H16ClNO3S/c1-20-12-4-2-3-11(9-12)13-10-18(7-8-21-13)16(19)14-5-6-15(17)22-14/h2-6,9,13H,7-8,10H2,1H3/t13-/m0/s1 |
| InChIKey | SGVUAWSSQLTOAP-ZDUSSCGKSA-N |
| XLogP | 3.62 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |