C20H21N3O3 — CID 136517505
[2-(3-methoxyphenyl)morpholin-4-yl]-(1-methylbenzimidazol-5-yl)methanone (PubChem CID 136517505) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)morpholin-4-yl]-(1-methylbenzimidazol-5-yl)methanone.
| Compound Name | [2-(3-methoxyphenyl)morpholin-4-yl]-(1-methylbenzimidazol-5-yl)methanone |
|---|---|
| PubChem CID | 136517505 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | [2-(3-methoxyphenyl)morpholin-4-yl]-(1-methylbenzimidazol-5-yl)methanone |
| SMILES | COc1cccc(C2CN(C(=O)c3ccc4c(c3)ncn4C)CCO2)c1 |
| InChI | InChI=1S/C20H21N3O3/c1-22-13-21-17-11-15(6-7-18(17)22)20(24)23-8-9-26-19(12-23)14-4-3-5-16(10-14)25-2/h3-7,10-11,13,19H,8-9,12H2,1-2H3 |
| InChIKey | WMCQWZJIFPETIM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |