C23H23NO5 — CID 95550019
(4-hydroxy-3-methoxyphenyl)-[(2S)-2-(6-methoxynaphthalen-2-yl)morpholin-4-yl]methanone (PubChem CID 95550019) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is (4-hydroxy-3-methoxyphenyl)-[(2S)-2-(6-methoxynaphthalen-2-yl)morpholin-4-yl]methanone.
| Compound Name | (4-hydroxy-3-methoxyphenyl)-[(2S)-2-(6-methoxynaphthalen-2-yl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 95550019 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | (4-hydroxy-3-methoxyphenyl)-[(2S)-2-(6-methoxynaphthalen-2-yl)morpholin-4-yl]methanone |
| SMILES | COc1ccc2cc([C@H]3CN(C(=O)c4ccc(O)c(OC)c4)CCO3)ccc2c1 |
| InChI | InChI=1S/C23H23NO5/c1-27-19-7-5-15-11-17(4-3-16(15)12-19)22-14-24(9-10-29-22)23(26)18-6-8-20(25)21(13-18)28-2/h3-8,11-13,22,25H,9-10,14H2,1-2H3/t22-/m1/s1 |
| InChIKey | BZQWCASMCBSCJV-JOCHJYFZSA-N |
| XLogP | 3.78 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |