C22H23N3O3 — CID 56874345
[2-(6-methoxynaphthalen-2-yl)morpholin-4-yl]-[2-(methylamino)-4-pyridinyl]methanone (PubChem CID 56874345) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is [2-(6-methoxynaphthalen-2-yl)morpholin-4-yl]-[2-(methylamino)-4-pyridinyl]methanone.
| Compound Name | [2-(6-methoxynaphthalen-2-yl)morpholin-4-yl]-[2-(methylamino)-4-pyridinyl]methanone |
|---|---|
| PubChem CID | 56874345 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | [2-(6-methoxynaphthalen-2-yl)morpholin-4-yl]-[2-(methylamino)-4-pyridinyl]methanone |
| SMILES | CNc1cc(C(=O)N2CCOC(c3ccc4cc(OC)ccc4c3)C2)ccn1 |
| InChI | InChI=1S/C22H23N3O3/c1-23-21-13-18(7-8-24-21)22(26)25-9-10-28-20(14-25)17-4-3-16-12-19(27-2)6-5-15(16)11-17/h3-8,11-13,20H,9-10,14H2,1-2H3,(H,23,24) |
| InChIKey | JFFFUERDHQXQFS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |