C20H23NO5 — CID 110327180
(3,5-dimethoxyphenyl)-[2-(4-methoxyphenyl)morpholin-4-yl]methanone (PubChem CID 110327180) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)-[2-(4-methoxyphenyl)morpholin-4-yl]methanone.
| Compound Name | (3,5-dimethoxyphenyl)-[2-(4-methoxyphenyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 110327180 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | (3,5-dimethoxyphenyl)-[2-(4-methoxyphenyl)morpholin-4-yl]methanone |
| SMILES | COc1ccc(C2CN(C(=O)c3cc(OC)cc(OC)c3)CCO2)cc1 |
| InChI | InChI=1S/C20H23NO5/c1-23-16-6-4-14(5-7-16)19-13-21(8-9-26-19)20(22)15-10-17(24-2)12-18(11-15)25-3/h4-7,10-12,19H,8-9,13H2,1-3H3 |
| InChIKey | YVXRHBMDSQNZFU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |