C19H19NO5 — CID 110327211
1,3-benzodioxol-5-yl-[2-(4-methoxyphenyl)morpholin-4-yl]methanone (PubChem CID 110327211) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-[2-(4-methoxyphenyl)morpholin-4-yl]methanone.
| Compound Name | 1,3-benzodioxol-5-yl-[2-(4-methoxyphenyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 110327211 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 1,3-benzodioxol-5-yl-[2-(4-methoxyphenyl)morpholin-4-yl]methanone |
| SMILES | COc1ccc(C2CN(C(=O)c3ccc4c(c3)OCO4)CCO2)cc1 |
| InChI | InChI=1S/C19H19NO5/c1-22-15-5-2-13(3-6-15)18-11-20(8-9-23-18)19(21)14-4-7-16-17(10-14)25-12-24-16/h2-7,10,18H,8-9,11-12H2,1H3 |
| InChIKey | UFVABIHDENMHFG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |