C18H16BrNO4 — CID 47913286
1,3-benzodioxol-5-yl-[2-(4-bromophenyl)morpholin-4-yl]methanone (PubChem CID 47913286) has the molecular formula C18H16BrNO4 and a molecular weight of 390.23 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-[2-(4-bromophenyl)morpholin-4-yl]methanone.
| Compound Name | 1,3-benzodioxol-5-yl-[2-(4-bromophenyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 47913286 |
| Molecular Formula | C18H16BrNO4 |
| Molecular Weight | 390.23 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | 1,3-benzodioxol-5-yl-[2-(4-bromophenyl)morpholin-4-yl]methanone |
| SMILES | O=C(c1ccc2c(c1)OCO2)N1CCOC(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C18H16BrNO4/c19-14-4-1-12(2-5-14)17-10-20(7-8-22-17)18(21)13-3-6-15-16(9-13)24-11-23-15/h1-6,9,17H,7-8,10-11H2 |
| InChIKey | FFYAHUILTSCBNN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.23 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |