C17H14BrN3O6 — CID 60587125
[2-(4-bromophenyl)morpholin-4-yl]-(3,5-dinitrophenyl)methanone (PubChem CID 60587125) has the molecular formula C17H14BrN3O6 and a molecular weight of 436.22 g/mol. Its IUPAC name is [2-(4-bromophenyl)morpholin-4-yl]-(3,5-dinitrophenyl)methanone.
| Compound Name | [2-(4-bromophenyl)morpholin-4-yl]-(3,5-dinitrophenyl)methanone |
|---|---|
| PubChem CID | 60587125 |
| Molecular Formula | C17H14BrN3O6 |
| Molecular Weight | 436.22 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | [2-(4-bromophenyl)morpholin-4-yl]-(3,5-dinitrophenyl)methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)N1CCOC(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C17H14BrN3O6/c18-13-3-1-11(2-4-13)16-10-19(5-6-27-16)17(22)12-7-14(20(23)24)9-15(8-12)21(25)26/h1-4,7-9,16H,5-6,10H2 |
| InChIKey | SGWQLUSQNANKBW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.22 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|