C17H15BrClNO2 — CID 47913302
[2-(4-bromophenyl)morpholin-4-yl]-(3-chlorophenyl)methanone (PubChem CID 47913302) has the molecular formula C17H15BrClNO2 and a molecular weight of 380.67 g/mol. Its IUPAC name is [2-(4-bromophenyl)morpholin-4-yl]-(3-chlorophenyl)methanone.
| Compound Name | [2-(4-bromophenyl)morpholin-4-yl]-(3-chlorophenyl)methanone |
|---|---|
| PubChem CID | 47913302 |
| Molecular Formula | C17H15BrClNO2 |
| Molecular Weight | 380.67 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | [2-(4-bromophenyl)morpholin-4-yl]-(3-chlorophenyl)methanone |
| SMILES | O=C(c1cccc(Cl)c1)N1CCOC(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C17H15BrClNO2/c18-14-6-4-12(5-7-14)16-11-20(8-9-22-16)17(21)13-2-1-3-15(19)10-13/h1-7,10,16H,8-9,11H2 |
| InChIKey | RVQKLEPZCGKZRY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.67 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |