C22H23ClN2O4 — CID 55948150
N-[3-[2-(4-chlorophenyl)morpholine-4-carbonyl]phenyl]oxolane-2-carboxamide (PubChem CID 55948150) has the molecular formula C22H23ClN2O4 and a molecular weight of 414.89 g/mol. Its IUPAC name is N-[3-[2-(4-chlorophenyl)morpholine-4-carbonyl]phenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[2-(4-chlorophenyl)morpholine-4-carbonyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 55948150 |
| Molecular Formula | C22H23ClN2O4 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | N-[3-[2-(4-chlorophenyl)morpholine-4-carbonyl]phenyl]oxolane-2-carboxamide |
| SMILES | O=C(Nc1cccc(C(=O)N2CCOC(c3ccc(Cl)cc3)C2)c1)C1CCCO1 |
| InChI | InChI=1S/C22H23ClN2O4/c23-17-8-6-15(7-9-17)20-14-25(10-12-29-20)22(27)16-3-1-4-18(13-16)24-21(26)19-5-2-11-28-19/h1,3-4,6-9,13,19-20H,2,5,10-12,14H2,(H,24,26) |
| InChIKey | RWUKFUMXOYXYOH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |