C17H14BrF2NO2 — CID 110364434
[2-(3-bromophenyl)morpholin-4-yl]-(3,4-difluorophenyl)methanone (PubChem CID 110364434) has the molecular formula C17H14BrF2NO2 and a molecular weight of 382.20 g/mol. Its IUPAC name is [2-(3-bromophenyl)morpholin-4-yl]-(3,4-difluorophenyl)methanone.
| Compound Name | [2-(3-bromophenyl)morpholin-4-yl]-(3,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 110364434 |
| Molecular Formula | C17H14BrF2NO2 |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | [2-(3-bromophenyl)morpholin-4-yl]-(3,4-difluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1)N1CCOC(c2cccc(Br)c2)C1 |
| InChI | InChI=1S/C17H14BrF2NO2/c18-13-3-1-2-11(8-13)16-10-21(6-7-23-16)17(22)12-4-5-14(19)15(20)9-12/h1-5,8-9,16H,6-7,10H2 |
| InChIKey | POEXGUZPFIEYSJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |